C14H26N4O2 — CID 111301255
N'-methyl-4-(oxolane-2-carbonyl)-N-propylpiperazine-1-carboximidamide (PubChem CID 111301255) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N'-methyl-4-(oxolane-2-carbonyl)-N-propylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxolane-2-carbonyl)-N-propylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301255 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N'-methyl-4-(oxolane-2-carbonyl)-N-propylpiperazine-1-carboximidamide |
| SMILES | CCCN/C(=N\C)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C14H26N4O2/c1-3-6-16-14(15-2)18-9-7-17(8-10-18)13(19)12-5-4-11-20-12/h12H,3-11H2,1-2H3,(H,15,16) |
| InChIKey | HAUSJEWJVVWKHK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|