C15H30IN5O4S — CID 111300796
N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111300796) has the molecular formula C15H30IN5O4S and a molecular weight of 503.41 g/mol. Its IUPAC name is N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111300796 |
| Molecular Formula | C15H30IN5O4S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C15H29N5O4S.HI/c1-3-25(22,23)18-7-6-17-15(16-2)20-10-8-19(9-11-20)14(21)13-5-4-12-24-13;/h13,18H,3-12H2,1-2H3,(H,16,17);1H |
| InChIKey | PHTGBGULVQORHC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|