C16H31N5O4S — CID 119131758
N'-methyl-4-(oxolane-2-carbonyl)-N-[2-(propan-2-ylsulfamoyl)ethyl]piperazine-1-carboximidamide (PubChem CID 119131758) has the molecular formula C16H31N5O4S and a molecular weight of 389.52 g/mol. Its IUPAC name is N'-methyl-4-(oxolane-2-carbonyl)-N-[2-(propan-2-ylsulfamoyl)ethyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[2-(propan-2-ylsulfamoyl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119131758 |
| Molecular Formula | C16H31N5O4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[2-(propan-2-ylsulfamoyl)ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCS(=O)(=O)NC(C)C)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C16H31N5O4S/c1-13(2)19-26(23,24)12-6-18-16(17-3)21-9-7-20(8-10-21)15(22)14-5-4-11-25-14/h13-14,19H,4-12H2,1-3H3,(H,17,18) |
| InChIKey | PQICTCVKAVNABL-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|