C17H31N5O4S — CID 111300551
N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111300551) has the molecular formula C17H31N5O4S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111300551 |
| Molecular Formula | C17H31N5O4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCN1CCS(=O)(=O)CC1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C17H31N5O4S/c1-18-17(19-4-5-20-10-13-27(24,25)14-11-20)22-8-6-21(7-9-22)16(23)15-3-2-12-26-15/h15H,2-14H2,1H3,(H,18,19) |
| InChIKey | FLEKJCYGUBOUIY-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|