C17H34N4O2 — CID 111738314
ethyl N-[1-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 111738314) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is ethyl N-[1-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 111738314 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | ethyl N-[1-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CN/C(=N\C)N1CCC(C)(C)C1)CC(C)C |
| InChI | InChI=1S/C17H34N4O2/c1-7-23-16(22)20-14(10-13(2)3)11-19-15(18-6)21-9-8-17(4,5)12-21/h13-14H,7-12H2,1-6H3,(H,18,19)(H,20,22) |
| InChIKey | GHATYTNMXKTYJS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|