C19H39IN4O4 — CID 111745924
ethyl N-[1-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]-4-methylpentan-2-yl]carbamate;hydroiodide (PubChem CID 111745924) has the molecular formula C19H39IN4O4 and a molecular weight of 514.45 g/mol. Its IUPAC name is ethyl N-[1-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]-4-methylpentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[1-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111745924 |
| Molecular Formula | C19H39IN4O4 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | ethyl N-[1-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(CN/C(=N\C)N1CCC(COCCOC)C1)CC(C)C.I |
| InChI | InChI=1S/C19H38N4O4.HI/c1-6-27-19(24)22-17(11-15(2)3)12-21-18(20-4)23-8-7-16(13-23)14-26-10-9-25-5;/h15-17H,6-14H2,1-5H3,(H,20,21)(H,22,24);1H |
| InChIKey | FLGIEVCFDAAFJM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|