C17H34N4O4 — CID 111745887
tert-butyl N-[2-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate (PubChem CID 111745887) has the molecular formula C17H34N4O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111745887 |
| Molecular Formula | C17H34N4O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | tert-butyl N-[2-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C17H34N4O4/c1-17(2,3)25-16(22)20-8-7-19-15(18-4)21-9-6-14(12-21)13-24-11-10-23-5/h14H,6-13H2,1-5H3,(H,18,19)(H,20,22) |
| InChIKey | IRBLLLNNIPDQNX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|