C17H34IN3O4 — CID 111748337
methyl 6-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]hexanoate;hydroiodide (PubChem CID 111748337) has the molecular formula C17H34IN3O4 and a molecular weight of 471.38 g/mol. Its IUPAC name is methyl 6-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]hexanoate;hydroiodide.
| Compound Name | methyl 6-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]hexanoate;hydroiodide |
|---|---|
| PubChem CID | 111748337 |
| Molecular Formula | C17H34IN3O4 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | methyl 6-[[C-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]hexanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCCC(=O)OC)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C17H33N3O4.HI/c1-18-17(19-9-6-4-5-7-16(21)23-3)20-10-8-15(13-20)14-24-12-11-22-2;/h15H,4-14H2,1-3H3,(H,18,19);1H |
| InChIKey | KYIGAXMWBMKCFN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|