C14H30N4O4S — CID 111745581
N-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111745581) has the molecular formula C14H30N4O4S and a molecular weight of 350.49 g/mol. Its IUPAC name is N-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111745581 |
| Molecular Formula | C14H30N4O4S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C14H30N4O4S/c1-4-23(19,20)17-7-6-16-14(15-2)18-8-5-13(11-18)12-22-10-9-21-3/h13,17H,4-12H2,1-3H3,(H,15,16) |
| InChIKey | WBCBSCVTNPDPCD-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|