C15H32N4O4S — CID 111747813
N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111747813) has the molecular formula C15H32N4O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747813 |
| Molecular Formula | C15H32N4O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)CC)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C15H32N4O4S/c1-4-16-15(17-7-8-18-24(20,21)5-2)19-9-6-14(12-19)13-23-11-10-22-3/h14,18H,4-13H2,1-3H3,(H,16,17) |
| InChIKey | VAKHVGSZDSNWRE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|