C21H42N4O2 — CID 111745831
N'-[3-(3,5-dimethylpiperidin-1-yl)propyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111745831) has the molecular formula C21H42N4O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is N'-[3-(3,5-dimethylpiperidin-1-yl)propyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[3-(3,5-dimethylpiperidin-1-yl)propyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111745831 |
| Molecular Formula | C21H42N4O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | N'-[3-(3,5-dimethylpiperidin-1-yl)propyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1CC(C)CC(C)C1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C21H42N4O2/c1-5-22-21(25-10-7-20(16-25)17-27-12-11-26-4)23-8-6-9-24-14-18(2)13-19(3)15-24/h18-20H,5-17H2,1-4H3,(H,22,23) |
| InChIKey | AQPVHPJIEGQQGY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|