C19H37N3O4 — CID 111745699
N-ethyl-3-(2-methoxyethoxymethyl)-N'-[3-(oxolan-2-ylmethoxy)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111745699) has the molecular formula C19H37N3O4 and a molecular weight of 371.52 g/mol. Its IUPAC name is N-ethyl-3-(2-methoxyethoxymethyl)-N'-[3-(oxolan-2-ylmethoxy)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-[3-(oxolan-2-ylmethoxy)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111745699 |
| Molecular Formula | C19H37N3O4 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-[3-(oxolan-2-ylmethoxy)propyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCOCC1CCCO1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C19H37N3O4/c1-3-20-19(21-8-5-10-24-16-18-6-4-11-26-18)22-9-7-17(14-22)15-25-13-12-23-2/h17-18H,3-16H2,1-2H3,(H,20,21) |
| InChIKey | NYPSQNFPTYALGW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|