C17H32IN5O2 — CID 111747349
N-ethyl-3-(2-methoxyethoxymethyl)-N'-(3-pyrazol-1-ylpropyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111747349) has the molecular formula C17H32IN5O2 and a molecular weight of 465.38 g/mol. Its IUPAC name is N-ethyl-3-(2-methoxyethoxymethyl)-N'-(3-pyrazol-1-ylpropyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-(3-pyrazol-1-ylpropyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111747349 |
| Molecular Formula | C17H32IN5O2 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-(3-pyrazol-1-ylpropyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCn1cccn1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C17H31N5O2.HI/c1-3-18-17(19-7-4-9-22-10-5-8-20-22)21-11-6-16(14-21)15-24-13-12-23-2;/h5,8,10,16H,3-4,6-7,9,11-15H2,1-2H3,(H,18,19);1H |
| InChIKey | KRLFBBIYJNCWIR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|