C25H44IN5O2 — CID 111747864
N-ethyl-3-(2-methoxyethoxymethyl)-N'-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111747864) has the molecular formula C25H44IN5O2 and a molecular weight of 573.56 g/mol. Its IUPAC name is N-ethyl-3-(2-methoxyethoxymethyl)-N'-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111747864 |
| Molecular Formula | C25H44IN5O2 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | N-ethyl-3-(2-methoxyethoxymethyl)-N'-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCN(C)CC1c1ccccc1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C25H43N5O2.HI/c1-4-26-25(30-14-11-22(19-30)21-32-18-17-31-3)27-12-8-13-29-16-15-28(2)20-24(29)23-9-6-5-7-10-23;/h5-7,9-10,22,24H,4,8,11-21H2,1-3H3,(H,26,27);1H |
| InChIKey | NVAPSFCCXONDDZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|