C20H34N4O4S — CID 111747466
N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111747466) has the molecular formula C20H34N4O4S and a molecular weight of 426.58 g/mol. Its IUPAC name is N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747466 |
| Molecular Formula | C20H34N4O4S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCc1ccccc1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C20H34N4O4S/c1-3-21-20(24-11-9-19(16-24)17-28-13-12-27-2)22-10-14-29(25,26)23-15-18-7-5-4-6-8-18/h4-8,19,23H,3,9-17H2,1-2H3,(H,21,22) |
| InChIKey | VKHXAOUQFSBPQE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|