C18H36IN5O3 — CID 110963732
ethyl N-[1-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide (PubChem CID 110963732) has the molecular formula C18H36IN5O3 and a molecular weight of 497.42 g/mol. Its IUPAC name is ethyl N-[1-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[1-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110963732 |
| Molecular Formula | C18H36IN5O3 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | ethyl N-[1-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C18H35N5O3.HI/c1-6-19-17(23-10-8-22(9-11-23)15(5)24)20-13-16(12-14(3)4)21-18(25)26-7-2;/h14,16H,6-13H2,1-5H3,(H,19,20)(H,21,25);1H |
| InChIKey | YTVAFTYTZOLCNI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|