C16H35IN4O3 — CID 110976196
ethyl N-[1-[[ethylamino-(3-methoxypropylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide (PubChem CID 110976196) has the molecular formula C16H35IN4O3 and a molecular weight of 458.39 g/mol. Its IUPAC name is ethyl N-[1-[[ethylamino-(3-methoxypropylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[1-[[ethylamino-(3-methoxypropylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110976196 |
| Molecular Formula | C16H35IN4O3 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | ethyl N-[1-[[ethylamino-(3-methoxypropylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)NCCCOC.I |
| InChI | InChI=1S/C16H34N4O3.HI/c1-6-17-15(18-9-8-10-22-5)19-12-14(11-13(3)4)20-16(21)23-7-2;/h13-14H,6-12H2,1-5H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | GTLHMWKZIJANJQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|