C17H37IN4O2S — CID 111628637
ethyl N-[1-[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide (PubChem CID 111628637) has the molecular formula C17H37IN4O2S and a molecular weight of 488.48 g/mol. Its IUPAC name is ethyl N-[1-[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[1-[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111628637 |
| Molecular Formula | C17H37IN4O2S |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | ethyl N-[1-[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)NCCCCSC.I |
| InChI | InChI=1S/C17H36N4O2S.HI/c1-6-18-16(19-10-8-9-11-24-5)20-13-15(12-14(3)4)21-17(22)23-7-2;/h14-15H,6-13H2,1-5H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | CAUBVBGOHUFARS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|