C19H36N4O4 — CID 111255257
methyl 1-[N'-[2-(ethoxycarbonylamino)-4-methylpentyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111255257) has the molecular formula C19H36N4O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is methyl 1-[N'-[2-(ethoxycarbonylamino)-4-methylpentyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-[2-(ethoxycarbonylamino)-4-methylpentyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111255257 |
| Molecular Formula | C19H36N4O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | methyl 1-[N'-[2-(ethoxycarbonylamino)-4-methylpentyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C19H36N4O4/c1-6-20-18(23-10-8-15(9-11-23)17(24)26-5)21-13-16(12-14(3)4)22-19(25)27-7-2/h14-16H,6-13H2,1-5H3,(H,20,21)(H,22,25) |
| InChIKey | USIZSRVXCDCABI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|