C15H28N4O3 — CID 111254473
methyl 1-[N-ethyl-N'-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254473) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254473 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCCNC(=O)C/N=C(\NCC)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C15H28N4O3/c1-4-8-17-13(20)11-18-15(16-5-2)19-9-6-12(7-10-19)14(21)22-3/h12H,4-11H2,1-3H3,(H,16,18)(H,17,20) |
| InChIKey | XMMQSESWNDHZMN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|