C20H30N4O3 — CID 111252587
methyl 1-[N-ethyl-N'-[2-(3-ethylanilino)-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111252587) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[2-(3-ethylanilino)-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[2-(3-ethylanilino)-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111252587 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[2-(3-ethylanilino)-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(CC)c1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-4-15-7-6-8-17(13-15)23-18(25)14-22-20(21-5-2)24-11-9-16(10-12-24)19(26)27-3/h6-8,13,16H,4-5,9-12,14H2,1-3H3,(H,21,22)(H,23,25) |
| InChIKey | LAFJNBDPQVAWBY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|