C15H27IN4O3 — CID 111254850
methyl 1-[N'-[2-(cyclopropylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111254850) has the molecular formula C15H27IN4O3 and a molecular weight of 438.31 g/mol. Its IUPAC name is methyl 1-[N'-[2-(cyclopropylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[2-(cyclopropylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111254850 |
| Molecular Formula | C15H27IN4O3 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | methyl 1-[N'-[2-(cyclopropylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CC1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C15H26N4O3.HI/c1-3-16-15(17-10-13(20)18-12-4-5-12)19-8-6-11(7-9-19)14(21)22-2;/h11-12H,3-10H2,1-2H3,(H,16,17)(H,18,20);1H |
| InChIKey | QZZLZLASNVMFSY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|