C15H27N3O2 — CID 119161269
methyl 1-[N-ethyl-N'-[(1-methylcyclopropyl)methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 119161269) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[(1-methylcyclopropyl)methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[(1-methylcyclopropyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 119161269 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[(1-methylcyclopropyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CC1(C)CC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C15H27N3O2/c1-4-16-14(17-11-15(2)7-8-15)18-9-5-12(6-10-18)13(19)20-3/h12H,4-11H2,1-3H3,(H,16,17) |
| InChIKey | CNAUXRXIXWNEOM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|