C20H36N4O2S — CID 111255239
methyl 1-[N-ethyl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111255239) has the molecular formula C20H36N4O2S and a molecular weight of 396.60 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111255239 |
| Molecular Formula | C20H36N4O2S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CC1(N2CCSCC2)CCCC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H36N4O2S/c1-3-21-19(23-10-6-17(7-11-23)18(25)26-2)22-16-20(8-4-5-9-20)24-12-14-27-15-13-24/h17H,3-16H2,1-2H3,(H,21,22) |
| InChIKey | RFRANKTZDYYRFS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|