C19H34N4O3S — CID 111254969
methyl 1-[N-ethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254969) has the molecular formula C19H34N4O3S and a molecular weight of 398.57 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254969 |
| Molecular Formula | C19H34N4O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCSC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C19H34N4O3S/c1-3-20-18(22-7-4-16(5-8-22)17(24)25-2)21-14-19(6-13-27-15-19)23-9-11-26-12-10-23/h16H,3-15H2,1-2H3,(H,20,21) |
| InChIKey | QPGDVLPNQCUWDC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|