C18H34N4OS2 — CID 109487747
N-ethyl-2,2-dimethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 109487747) has the molecular formula C18H34N4OS2 and a molecular weight of 386.63 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109487747 |
| Molecular Formula | C18H34N4OS2 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCSC1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C18H34N4OS2/c1-4-19-16(21-8-12-25-17(2,3)14-21)20-13-18(5-11-24-15-18)22-6-9-23-10-7-22/h4-15H2,1-3H3,(H,19,20) |
| InChIKey | SEKVVKAUBSFSLA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|