C21H33IN4OS — CID 110946427
N-ethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 110946427) has the molecular formula C21H33IN4OS and a molecular weight of 516.49 g/mol. Its IUPAC name is N-ethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110946427 |
| Molecular Formula | C21H33IN4OS |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-ethyl-N'-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCSC1)N1CCc2ccccc2C1.I |
| InChI | InChI=1S/C21H32N4OS.HI/c1-2-22-20(24-9-7-18-5-3-4-6-19(18)15-24)23-16-21(8-14-27-17-21)25-10-12-26-13-11-25;/h3-6H,2,7-17H2,1H3,(H,22,23);1H |
| InChIKey | SZWAZYIXVZLPPG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|