C22H35N3O2S — CID 109488552
N-ethyl-N'-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide (PubChem CID 109488552) has the molecular formula C22H35N3O2S and a molecular weight of 405.61 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488552 |
| Molecular Formula | C22H35N3O2S |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-ethyl-N'-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2ccc(OC)cc2)CCOCC1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C22H35N3O2S/c1-5-23-20(25-12-15-28-21(2,3)17-25)24-16-22(10-13-27-14-11-22)18-6-8-19(26-4)9-7-18/h6-9H,5,10-17H2,1-4H3,(H,23,24) |
| InChIKey | IHWCFYWTOFKTHZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|