C17H28IN3OS — CID 109488262
N-[2-(4-methoxyphenyl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488262) has the molecular formula C17H28IN3OS and a molecular weight of 449.40 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488262 |
| Molecular Formula | C17H28IN3OS |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(OC)cc1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C17H27N3OS.HI/c1-17(2)13-20(11-12-22-17)16(18-3)19-10-9-14-5-7-15(21-4)8-6-14;/h5-8H,9-13H2,1-4H3,(H,18,19);1H |
| InChIKey | SNTMSVCIMRVEMC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|