C18H30IN3O — CID 109452664
N-[2-(4-methoxyphenyl)ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109452664) has the molecular formula C18H30IN3O and a molecular weight of 431.36 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109452664 |
| Molecular Formula | C18H30IN3O |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(OC)cc1)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C18H29N3O.HI/c1-17(2)13-21(18(17,3)4)16(19-5)20-12-11-14-7-9-15(22-6)10-8-14;/h7-10H,11-13H2,1-6H3,(H,19,20);1H |
| InChIKey | MBPLQSOSSPPYKR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|