C18H28IN3O2 — CID 109451908
methyl 4-[[[N-methyl-C-(2,2,3,3-tetramethylazetidin-1-yl)carbonimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 109451908) has the molecular formula C18H28IN3O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is methyl 4-[[[N-methyl-C-(2,2,3,3-tetramethylazetidin-1-yl)carbonimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[[[N-methyl-C-(2,2,3,3-tetramethylazetidin-1-yl)carbonimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 109451908 |
| Molecular Formula | C18H28IN3O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | methyl 4-[[[N-methyl-C-(2,2,3,3-tetramethylazetidin-1-yl)carbonimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)OC)cc1)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C18H27N3O2.HI/c1-17(2)12-21(18(17,3)4)16(19-5)20-11-13-7-9-14(10-8-13)15(22)23-6;/h7-10H,11-12H2,1-6H3,(H,19,20);1H |
| InChIKey | NXRUQHVSIUDLGN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|