C17H26F2IN3 — CID 109453949
N-[2-(3,5-difluorophenyl)ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109453949) has the molecular formula C17H26F2IN3 and a molecular weight of 437.32 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109453949 |
| Molecular Formula | C17H26F2IN3 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1cc(F)cc(F)c1)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C17H25F2N3.HI/c1-16(2)11-22(17(16,3)4)15(20-5)21-7-6-12-8-13(18)10-14(19)9-12;/h8-10H,6-7,11H2,1-5H3,(H,20,21);1H |
| InChIKey | QLJQDKVVUMXTMY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|