C14H23ClIN3S2 — CID 109487566
N-[2-(5-chlorothiophen-2-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109487566) has the molecular formula C14H23ClIN3S2 and a molecular weight of 459.85 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109487566 |
| Molecular Formula | C14H23ClIN3S2 |
| Molecular Weight | 459.85 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(Cl)s1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C14H22ClN3S2.HI/c1-14(2)10-18(8-9-19-14)13(16-3)17-7-6-11-4-5-12(15)20-11;/h4-5H,6-10H2,1-3H3,(H,16,17);1H |
| InChIKey | DOXQPMWEODVSNT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|