C16H24ClN3S — CID 111733201
N-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide (PubChem CID 111733201) has the molecular formula C16H24ClN3S and a molecular weight of 325.91 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide |
|---|---|
| PubChem CID | 111733201 |
| Molecular Formula | C16H24ClN3S |
| Molecular Weight | 325.91 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide |
| SMILES | C/N=C(\NCCc1ccc(Cl)s1)N1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C16H24ClN3S/c1-18-15(19-10-6-13-4-5-14(17)21-13)20-11-9-16(12-20)7-2-3-8-16/h4-5H,2-3,6-12H2,1H3,(H,18,19) |
| InChIKey | QBMHHHDDJUCASW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|