C14H24IN3S2 — CID 109487510
N',2,2-trimethyl-N-(2-thiophen-2-ylethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109487510) has the molecular formula C14H24IN3S2 and a molecular weight of 425.41 g/mol. Its IUPAC name is N',2,2-trimethyl-N-(2-thiophen-2-ylethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N',2,2-trimethyl-N-(2-thiophen-2-ylethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109487510 |
| Molecular Formula | C14H24IN3S2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | N',2,2-trimethyl-N-(2-thiophen-2-ylethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1cccs1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C14H23N3S2.HI/c1-14(2)11-17(8-10-19-14)13(15-3)16-7-6-12-5-4-9-18-12;/h4-5,9H,6-8,10-11H2,1-3H3,(H,15,16);1H |
| InChIKey | BXCZIHOMKNAUTC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|