C17H28IN3OS — CID 109490046
N',2,2-trimethyl-N-(2-phenylmethoxyethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109490046) has the molecular formula C17H28IN3OS and a molecular weight of 449.40 g/mol. Its IUPAC name is N',2,2-trimethyl-N-(2-phenylmethoxyethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N',2,2-trimethyl-N-(2-phenylmethoxyethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490046 |
| Molecular Formula | C17H28IN3OS |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N',2,2-trimethyl-N-(2-phenylmethoxyethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCOCc1ccccc1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C17H27N3OS.HI/c1-17(2)14-20(10-12-22-17)16(18-3)19-9-11-21-13-15-7-5-4-6-8-15;/h4-8H,9-14H2,1-3H3,(H,18,19);1H |
| InChIKey | QUQZMSLTNISQCL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|