C21H35N7S — CID 111208070
N-ethyl-4-pyrimidin-2-yl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]piperazine-1-carboximidamide (PubChem CID 111208070) has the molecular formula C21H35N7S and a molecular weight of 417.63 g/mol. Its IUPAC name is N-ethyl-4-pyrimidin-2-yl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-pyrimidin-2-yl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111208070 |
| Molecular Formula | C21H35N7S |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | N-ethyl-4-pyrimidin-2-yl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(N2CCSCC2)CCCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H35N7S/c1-2-22-19(26-10-12-27(13-11-26)20-23-8-5-9-24-20)25-18-21(6-3-4-7-21)28-14-16-29-17-15-28/h5,8-9H,2-4,6-7,10-18H2,1H3,(H,22,25) |
| InChIKey | ULXMQFICJWHYBD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|