C19H35N5OS — CID 111927221
N-[2-[[N-ethyl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111927221) has the molecular formula C19H35N5OS and a molecular weight of 381.59 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111927221 |
| Molecular Formula | C19H35N5OS |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CC1(N2CCSCC2)CCCC1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C19H35N5OS/c1-2-20-18(22-10-9-21-17(25)16-5-6-16)23-15-19(7-3-4-8-19)24-11-13-26-14-12-24/h16H,2-15H2,1H3,(H,21,25)(H2,20,22,23) |
| InChIKey | LYLSZIAHKAOSAW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|