C19H30F3N5S2 — CID 111688424
1-ethyl-2-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111688424) has the molecular formula C19H30F3N5S2 and a molecular weight of 449.61 g/mol. Its IUPAC name is 1-ethyl-2-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111688424 |
| Molecular Formula | C19H30F3N5S2 |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-ethyl-2-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CC1(N2CCSCC2)CCCC1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C19H30F3N5S2/c1-2-23-17(24-8-5-16-26-15(13-29-16)19(20,21)22)25-14-18(6-3-4-7-18)27-9-11-28-12-10-27/h13H,2-12,14H2,1H3,(H2,23,24,25) |
| InChIKey | LWIQOVOQPMVXLK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|