C17H29F3N6S — CID 111688484
1-ethyl-2-[2-(4-methylpiperazin-1-yl)propyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111688484) has the molecular formula C17H29F3N6S and a molecular weight of 406.52 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methylpiperazin-1-yl)propyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(4-methylpiperazin-1-yl)propyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111688484 |
| Molecular Formula | C17H29F3N6S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-ethyl-2-[2-(4-methylpiperazin-1-yl)propyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)N1CCN(C)CC1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C17H29F3N6S/c1-4-21-16(23-11-13(2)26-9-7-25(3)8-10-26)22-6-5-15-24-14(12-27-15)17(18,19)20/h12-13H,4-11H2,1-3H3,(H2,21,22,23) |
| InChIKey | DKWCHLUPISXWHH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|