C20H39N5O — CID 110963937
4-acetyl-N'-[2-(azepan-1-yl)-3-methylbutyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 110963937) has the molecular formula C20H39N5O and a molecular weight of 365.57 g/mol. Its IUPAC name is 4-acetyl-N'-[2-(azepan-1-yl)-3-methylbutyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-[2-(azepan-1-yl)-3-methylbutyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963937 |
| Molecular Formula | C20H39N5O |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.32 |
| IUPAC Name | 4-acetyl-N'-[2-(azepan-1-yl)-3-methylbutyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C(C)C)N1CCCCCC1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C20H39N5O/c1-5-21-20(25-14-12-23(13-15-25)18(4)26)22-16-19(17(2)3)24-10-8-6-7-9-11-24/h17,19H,5-16H2,1-4H3,(H,21,22) |
| InChIKey | ZVMRIVCSILNOHY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|