C18H34F3N5O2 — CID 111916248
ethyl N-[1-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 111916248) has the molecular formula C18H34F3N5O2 and a molecular weight of 409.50 g/mol. Its IUPAC name is ethyl N-[1-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 111916248 |
| Molecular Formula | C18H34F3N5O2 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | ethyl N-[1-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H34F3N5O2/c1-5-22-16(24-14-7-8-26(11-14)12-18(19,20)21)23-10-15(9-13(3)4)25-17(27)28-6-2/h13-15H,5-12H2,1-4H3,(H,25,27)(H2,22,23,24) |
| InChIKey | FSDODJPIEGWAOA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|