C9H20N2O2 — CID 39869686
ethyl N-[(2S)-1-amino-4-methylpentan-2-yl]carbamate (PubChem CID 39869686) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is ethyl N-[(2S)-1-amino-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[(2S)-1-amino-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 39869686 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | ethyl N-[(2S)-1-amino-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@H](CN)CC(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-4-13-9(12)11-8(6-10)5-7(2)3/h7-8H,4-6,10H2,1-3H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | DMIHYDRZOKDMEP-QMMMGPOBSA-N |
| XLogP | 1.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |