C10H22N2O4S — CID 42960435
ethyl N-[1-(methanesulfonamido)-4-methylpentan-2-yl]carbamate (PubChem CID 42960435) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is ethyl N-[1-(methanesulfonamido)-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-(methanesulfonamido)-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 42960435 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | ethyl N-[1-(methanesulfonamido)-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNS(C)(=O)=O)CC(C)C |
| InChI | InChI=1S/C10H22N2O4S/c1-5-16-10(13)12-9(6-8(2)3)7-11-17(4,14)15/h8-9,11H,5-7H2,1-4H3,(H,12,13) |
| InChIKey | CFWOVVNLJSTLKZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |