C19H27N3O4S — CID 46457653
ethyl N-[4-methyl-1-[(3-methylquinolin-8-yl)sulfonylamino]pentan-2-yl]carbamate (PubChem CID 46457653) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[(3-methylquinolin-8-yl)sulfonylamino]pentan-2-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-1-[(3-methylquinolin-8-yl)sulfonylamino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 46457653 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | ethyl N-[4-methyl-1-[(3-methylquinolin-8-yl)sulfonylamino]pentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNS(=O)(=O)c1cccc2cc(C)cnc12)CC(C)C |
| InChI | InChI=1S/C19H27N3O4S/c1-5-26-19(23)22-16(9-13(2)3)12-21-27(24,25)17-8-6-7-15-10-14(4)11-20-18(15)17/h6-8,10-11,13,16,21H,5,9,12H2,1-4H3,(H,22,23) |
| InChIKey | UFPZAWOZKYKAKU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |