C14H18N2O3S — CID 106844087
N-(4-hydroxybutyl)-3-methylquinoline-8-sulfonamide (PubChem CID 106844087) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-3-methylquinoline-8-sulfonamide.
| Compound Name | N-(4-hydroxybutyl)-3-methylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 106844087 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(4-hydroxybutyl)-3-methylquinoline-8-sulfonamide |
| SMILES | Cc1cnc2c(S(=O)(=O)NCCCCO)cccc2c1 |
| InChI | InChI=1S/C14H18N2O3S/c1-11-9-12-5-4-6-13(14(12)15-10-11)20(18,19)16-7-2-3-8-17/h4-6,9-10,16-17H,2-3,7-8H2,1H3 |
| InChIKey | SDYHMSXOZREISU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|