C15H18N2O2S — CID 113236576
3-methyl-N-[(E)-pent-3-enyl]quinoline-8-sulfonamide (PubChem CID 113236576) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-methyl-N-[(E)-pent-3-enyl]quinoline-8-sulfonamide.
| Compound Name | 3-methyl-N-[(E)-pent-3-enyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 113236576 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-methyl-N-[(E)-pent-3-enyl]quinoline-8-sulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1cccc2cc(C)cnc12 |
| InChI | InChI=1S/C15H18N2O2S/c1-3-4-5-9-17-20(18,19)14-8-6-7-13-10-12(2)11-16-15(13)14/h3-4,6-8,10-11,17H,5,9H2,1-2H3/b4-3+ |
| InChIKey | JFHWLUFZPGVVGQ-ONEGZZNKSA-N |
| XLogP | 2.79 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|