C15H22ClN3O3S — CID 120717516
N-[2-(2-methoxyethylamino)ethyl]-3-methylquinoline-8-sulfonamide;hydrochloride (PubChem CID 120717516) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-3-methylquinoline-8-sulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-3-methylquinoline-8-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717516 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-3-methylquinoline-8-sulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1cccc2cc(C)cnc12.Cl |
| InChI | InChI=1S/C15H21N3O3S.ClH/c1-12-10-13-4-3-5-14(15(13)17-11-12)22(19,20)18-7-6-16-8-9-21-2;/h3-5,10-11,16,18H,6-9H2,1-2H3;1H |
| InChIKey | XEMGZLIDHXQLQG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|