C13H14F2N2O3S — CID 103836890
N-(3,3-difluoro-2-hydroxypropyl)-3-methylquinoline-8-sulfonamide (PubChem CID 103836890) has the molecular formula C13H14F2N2O3S and a molecular weight of 316.33 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-3-methylquinoline-8-sulfonamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-3-methylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 103836890 |
| Molecular Formula | C13H14F2N2O3S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-3-methylquinoline-8-sulfonamide |
| SMILES | Cc1cnc2c(S(=O)(=O)NCC(O)C(F)F)cccc2c1 |
| InChI | InChI=1S/C13H14F2N2O3S/c1-8-5-9-3-2-4-11(12(9)16-6-8)21(19,20)17-7-10(18)13(14)15/h2-6,10,13,17-18H,7H2,1H3 |
| InChIKey | PKMKJPFEXJLPMC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |