C18H33N5O3 — CID 109428693
ethyl N-[1-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 109428693) has the molecular formula C18H33N5O3 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl N-[1-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 109428693 |
| Molecular Formula | C18H33N5O3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | ethyl N-[1-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCC(CC(C)C)NC(=O)OCC |
| InChI | InChI=1S/C18H33N5O3/c1-7-19-17(21-11-16-22-13(5)14(6)26-16)20-10-15(9-12(3)4)23-18(24)25-8-2/h12,15H,7-11H2,1-6H3,(H,23,24)(H2,19,20,21) |
| InChIKey | XYEJSUIKRXKAKW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|